C17H24N3O4S+ — CID 54686866
(E,5R)-3-hydroxy-1-methoxy-6,6-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-1-oxohept-2-ene-2-diazonium (PubChem CID 54686866) has the molecular formula C17H24N3O4S+ and a molecular weight of 366.46 g/mol. Its IUPAC name is (E,5R)-3-hydroxy-1-methoxy-6,6-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-1-oxohept-2-ene-2-diazonium.
| Compound Name | (E,5R)-3-hydroxy-1-methoxy-6,6-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-1-oxohept-2-ene-2-diazonium |
|---|---|
| PubChem CID | 54686866 |
| Molecular Formula | C17H24N3O4S+ |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (E,5R)-3-hydroxy-1-methoxy-6,6-dimethyl-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-1-oxohept-2-ene-2-diazonium |
| SMILES | COC(=O)/C([N+]#N)=C(\O)C[C@@H](N[S@@](=O)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H23N3O4S/c1-11-6-8-12(9-7-11)25(23)20-14(17(2,3)4)10-13(21)15(19-18)16(22)24-5/h6-9,14,20H,10H2,1-5H3/p+1/t14-,25+/m1/s1 |
| InChIKey | LVJNPSJEVWTJND-PWECECGKSA-O |
| XLogP | 3.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|