C29H33NO4S2 — CID 102383304
tert-butyl (3R,4R)-3-[(2-methylphenyl)sulfanylmethyl]-4-[(4-methylphenyl)sulfinylamino]-2-oxo-4-phenylbutanoate (PubChem CID 102383304) has the molecular formula C29H33NO4S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[(2-methylphenyl)sulfanylmethyl]-4-[(4-methylphenyl)sulfinylamino]-2-oxo-4-phenylbutanoate.
| Compound Name | tert-butyl (3R,4R)-3-[(2-methylphenyl)sulfanylmethyl]-4-[(4-methylphenyl)sulfinylamino]-2-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 102383304 |
| Molecular Formula | C29H33NO4S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | tert-butyl (3R,4R)-3-[(2-methylphenyl)sulfanylmethyl]-4-[(4-methylphenyl)sulfinylamino]-2-oxo-4-phenylbutanoate |
| SMILES | Cc1ccc(S(=O)N[C@@H](c2ccccc2)[C@@H](CSc2ccccc2C)C(=O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H33NO4S2/c1-20-15-17-23(18-16-20)36(33)30-26(22-12-7-6-8-13-22)24(27(31)28(32)34-29(3,4)5)19-35-25-14-10-9-11-21(25)2/h6-18,24,26,30H,19H2,1-5H3/t24-,26+,36?/m1/s1 |
| InChIKey | PBRVTRQTNPLACG-ILOWSARNSA-N |
| XLogP | 5.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|