C21H23ClFN2O4P — CID 24939117
N-[(2-chloro-7-methoxyquinolin-3-yl)-diethoxyphosphorylmethyl]-3-fluoroaniline (PubChem CID 24939117) has the molecular formula C21H23ClFN2O4P and a molecular weight of 452.85 g/mol. Its IUPAC name is N-[(2-chloro-7-methoxyquinolin-3-yl)-diethoxyphosphorylmethyl]-3-fluoroaniline.
| Compound Name | N-[(2-chloro-7-methoxyquinolin-3-yl)-diethoxyphosphorylmethyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 24939117 |
| Molecular Formula | C21H23ClFN2O4P |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[(2-chloro-7-methoxyquinolin-3-yl)-diethoxyphosphorylmethyl]-3-fluoroaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1cccc(F)c1)c1cc2ccc(OC)cc2nc1Cl |
| InChI | InChI=1S/C21H23ClFN2O4P/c1-4-28-30(26,29-5-2)21(24-16-8-6-7-15(23)12-16)18-11-14-9-10-17(27-3)13-19(14)25-20(18)22/h6-13,21,24H,4-5H2,1-3H3 |
| InChIKey | RRTDNDNIPVNIFF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|