C17H13ClF2N2O — CID 46551954
N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-3,5-difluoroaniline (PubChem CID 46551954) has the molecular formula C17H13ClF2N2O and a molecular weight of 334.75 g/mol. Its IUPAC name is N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-3,5-difluoroaniline.
| Compound Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 46551954 |
| Molecular Formula | C17H13ClF2N2O |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-3,5-difluoroaniline |
| SMILES | COc1ccc2cc(CNc3cc(F)cc(F)c3)c(Cl)nc2c1 |
| InChI | InChI=1S/C17H13ClF2N2O/c1-23-15-3-2-10-4-11(17(18)22-16(10)8-15)9-21-14-6-12(19)5-13(20)7-14/h2-8,21H,9H2,1H3 |
| InChIKey | XFFNPOJDVRGUBW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|