C17H22ClNO2 — CID 66234728
2-chloro-3-(3,3-dimethylbutoxymethyl)-7-methoxyquinoline (PubChem CID 66234728) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-chloro-3-(3,3-dimethylbutoxymethyl)-7-methoxyquinoline.
| Compound Name | 2-chloro-3-(3,3-dimethylbutoxymethyl)-7-methoxyquinoline |
|---|---|
| PubChem CID | 66234728 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-chloro-3-(3,3-dimethylbutoxymethyl)-7-methoxyquinoline |
| SMILES | COc1ccc2cc(COCCC(C)(C)C)c(Cl)nc2c1 |
| InChI | InChI=1S/C17H22ClNO2/c1-17(2,3)7-8-21-11-13-9-12-5-6-14(20-4)10-15(12)19-16(13)18/h5-6,9-10H,7-8,11H2,1-4H3 |
| InChIKey | BNMWYCUZNJYYCZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|