C18H23BrNO3P — CID 11863218
(S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]methanol (PubChem CID 11863218) has the molecular formula C18H23BrNO3P and a molecular weight of 412.26 g/mol. Its IUPAC name is (S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]methanol.
| Compound Name | (S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]methanol |
|---|---|
| PubChem CID | 11863218 |
| Molecular Formula | C18H23BrNO3P |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (S)-(4-bromophenyl)-[[4-(dimethylamino)phenyl]-propoxyphosphoryl]methanol |
| SMILES | CCCO[P@@](=O)(c1ccc(N(C)C)cc1)[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H23BrNO3P/c1-4-13-23-24(22,17-11-9-16(10-12-17)20(2)3)18(21)14-5-7-15(19)8-6-14/h5-12,18,21H,4,13H2,1-3H3/t18-,24-/m0/s1 |
| InChIKey | XPCMLOKOPQEVDL-UUOWRZLLSA-N |
| XLogP | 4.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|