C26H37O6P — CID 23850231
[(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylphosphoryl]-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 23850231) has the molecular formula C26H37O6P and a molecular weight of 476.55 g/mol. Its IUPAC name is [(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylphosphoryl]-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | [(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylphosphoryl]-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 23850231 |
| Molecular Formula | C26H37O6P |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [(5-methyl-2-propan-2-ylcyclohexyl)oxy-phenylphosphoryl]-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)P(=O)(OC2CC(C)CCC2C(C)C)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H37O6P/c1-17(2)21-13-12-18(3)14-22(21)32-33(28,20-10-8-7-9-11-20)26(27)19-15-23(29-4)25(31-6)24(16-19)30-5/h7-11,15-18,21-22,26-27H,12-14H2,1-6H3 |
| InChIKey | LEUVHAUFNXYYTQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|