C19H27N2O3P — CID 663201
[[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-pyridin-2-ylmethanol (PubChem CID 663201) has the molecular formula C19H27N2O3P and a molecular weight of 362.41 g/mol. Its IUPAC name is [[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-pyridin-2-ylmethanol.
| Compound Name | [[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 663201 |
| Molecular Formula | C19H27N2O3P |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [[4-(dimethylamino)phenyl]-(3-methylbutoxy)phosphoryl]-pyridin-2-ylmethanol |
| SMILES | CC(C)CCOP(=O)(c1ccc(N(C)C)cc1)C(O)c1ccccn1 |
| InChI | InChI=1S/C19H27N2O3P/c1-15(2)12-14-24-25(23,19(22)18-7-5-6-13-20-18)17-10-8-16(9-11-17)21(3)4/h5-11,13,15,19,22H,12,14H2,1-4H3 |
| InChIKey | BDRVQEMFJKLJAO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|