C19H26NO3P — CID 11859839
(1S)-1-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-2-methylpropan-1-ol (PubChem CID 11859839) has the molecular formula C19H26NO3P and a molecular weight of 347.40 g/mol. Its IUPAC name is (1S)-1-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-2-methylpropan-1-ol.
| Compound Name | (1S)-1-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 11859839 |
| Molecular Formula | C19H26NO3P |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (1S)-1-[[4-(dimethylamino)phenyl]-phenylmethoxyphosphoryl]-2-methylpropan-1-ol |
| SMILES | CC(C)[C@@H](O)[P@@](=O)(OCc1ccccc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H26NO3P/c1-15(2)19(21)24(22,23-14-16-8-6-5-7-9-16)18-12-10-17(11-13-18)20(3)4/h5-13,15,19,21H,14H2,1-4H3/t19-,24-/m0/s1 |
| InChIKey | ZHRFEFSAGNFATC-CYFREDJKSA-N |
| XLogP | 3.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|