C20H27CsO7S — CID 173139330
cesium;4-(1-cyclohexylcyclohexyl)oxycarbonyl-3-sulfobenzoic acid;hydride (PubChem CID 173139330) has the molecular formula C20H27CsO7S and a molecular weight of 544.40 g/mol. Its IUPAC name is cesium;4-(1-cyclohexylcyclohexyl)oxycarbonyl-3-sulfobenzoic acid;hydride.
| Compound Name | cesium;4-(1-cyclohexylcyclohexyl)oxycarbonyl-3-sulfobenzoic acid;hydride |
|---|---|
| PubChem CID | 173139330 |
| Molecular Formula | C20H27CsO7S |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | cesium;4-(1-cyclohexylcyclohexyl)oxycarbonyl-3-sulfobenzoic acid;hydride |
| SMILES | O=C(O)c1ccc(C(=O)OC2(C3CCCCC3)CCCCC2)c(S(=O)(=O)O)c1.[Cs+].[H-] |
| InChI | InChI=1S/C20H26O7S.Cs.H/c21-18(22)14-9-10-16(17(13-14)28(24,25)26)19(23)27-20(11-5-2-6-12-20)15-7-3-1-4-8-15;;/h9-10,13,15H,1-8,11-12H2,(H,21,22)(H,24,25,26);;/q;+1;-1 |
| InChIKey | YIYNPKIZISFHLS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|