C20H27NaO7S — CID 173139352
sodium;2,5-bis(cyclohexyloxycarbonyl)benzenesulfonic acid;hydride (PubChem CID 173139352) has the molecular formula C20H27NaO7S and a molecular weight of 434.49 g/mol. Its IUPAC name is sodium;2,5-bis(cyclohexyloxycarbonyl)benzenesulfonic acid;hydride.
| Compound Name | sodium;2,5-bis(cyclohexyloxycarbonyl)benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173139352 |
| Molecular Formula | C20H27NaO7S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | sodium;2,5-bis(cyclohexyloxycarbonyl)benzenesulfonic acid;hydride |
| SMILES | O=C(OC1CCCCC1)c1ccc(C(=O)OC2CCCCC2)c(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C20H26O7S.Na.H/c21-19(26-15-7-3-1-4-8-15)14-11-12-17(18(13-14)28(23,24)25)20(22)27-16-9-5-2-6-10-16;;/h11-13,15-16H,1-10H2,(H,23,24,25);;/q;+1;-1 |
| InChIKey | GEHJGENNSCBWOI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|