C8H7LiO10S2 — CID 174776590
lithium;4,5-disulfobenzene-1,3-dicarboxylic acid;hydride (PubChem CID 174776590) has the molecular formula C8H7LiO10S2 and a molecular weight of 334.21 g/mol. Its IUPAC name is lithium;4,5-disulfobenzene-1,3-dicarboxylic acid;hydride.
| Compound Name | lithium;4,5-disulfobenzene-1,3-dicarboxylic acid;hydride |
|---|---|
| PubChem CID | 174776590 |
| Molecular Formula | C8H7LiO10S2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | lithium;4,5-disulfobenzene-1,3-dicarboxylic acid;hydride |
| SMILES | O=C(O)c1cc(C(=O)O)c(S(=O)(=O)O)c(S(=O)(=O)O)c1.[H-].[Li+] |
| InChI | InChI=1S/C8H6O10S2.Li.H/c9-7(10)3-1-4(8(11)12)6(20(16,17)18)5(2-3)19(13,14)15;;/h1-2H,(H,9,10)(H,11,12)(H,13,14,15)(H,16,17,18);;/q;+1;-1 |
| InChIKey | YZHBBVCMXVKIEC-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|