C18H16O14S2 — CID 158513930
3,5-dimethyl-2-sulfoterephthalic acid;2-sulfoterephthalic acid (PubChem CID 158513930) has the molecular formula C18H16O14S2 and a molecular weight of 520.45 g/mol. Its IUPAC name is 3,5-dimethyl-2-sulfoterephthalic acid;2-sulfoterephthalic acid.
| Compound Name | 3,5-dimethyl-2-sulfoterephthalic acid;2-sulfoterephthalic acid |
|---|---|
| PubChem CID | 158513930 |
| Molecular Formula | C18H16O14S2 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | 3,5-dimethyl-2-sulfoterephthalic acid;2-sulfoterephthalic acid |
| SMILES | Cc1cc(C(=O)O)c(S(=O)(=O)O)c(C)c1C(=O)O.O=C(O)c1ccc(C(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H10O7S.C8H6O7S/c1-4-3-6(9(11)12)8(18(15,16)17)5(2)7(4)10(13)14;9-7(10)4-1-2-5(8(11)12)6(3-4)16(13,14)15/h3H,1-2H3,(H,11,12)(H,13,14)(H,15,16,17);1-3H,(H,9,10)(H,11,12)(H,13,14,15) |
| InChIKey | HLJZDLQXXIFBAL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 257.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|