C22H22N2O14S2 — CID 19067435
2-[4-[(E)-2-[4-[bis(carboxymethyl)amino]-2-sulfophenyl]ethenyl]-N-(carboxymethyl)-3-sulfoanilino]acetic acid (PubChem CID 19067435) has the molecular formula C22H22N2O14S2 and a molecular weight of 602.55 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-[bis(carboxymethyl)amino]-2-sulfophenyl]ethenyl]-N-(carboxymethyl)-3-sulfoanilino]acetic acid.
| Compound Name | 2-[4-[(E)-2-[4-[bis(carboxymethyl)amino]-2-sulfophenyl]ethenyl]-N-(carboxymethyl)-3-sulfoanilino]acetic acid |
|---|---|
| PubChem CID | 19067435 |
| Molecular Formula | C22H22N2O14S2 |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | 2-[4-[(E)-2-[4-[bis(carboxymethyl)amino]-2-sulfophenyl]ethenyl]-N-(carboxymethyl)-3-sulfoanilino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1ccc(/C=C/c2ccc(N(CC(=O)O)CC(=O)O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C22H22N2O14S2/c25-19(26)9-23(10-20(27)28)15-5-3-13(17(7-15)39(33,34)35)1-2-14-4-6-16(8-18(14)40(36,37)38)24(11-21(29)30)12-22(31)32/h1-8H,9-12H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34,35)(H,36,37,38)/b2-1+ |
| InChIKey | ZMZINVWFOGDBHB-OWOJBTEDSA-N |
| XLogP | 0.30 |
| TPSA | 264.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|