C11H11N3O3S — CID 174809861
1-naphthalen-1-yl-1-sulfamoylurea (PubChem CID 174809861) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-naphthalen-1-yl-1-sulfamoylurea.
| Compound Name | 1-naphthalen-1-yl-1-sulfamoylurea |
|---|---|
| PubChem CID | 174809861 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-naphthalen-1-yl-1-sulfamoylurea |
| SMILES | NC(=O)N(c1cccc2ccccc12)S(N)(=O)=O |
| InChI | InChI=1S/C11H11N3O3S/c12-11(15)14(18(13,16)17)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,12,15)(H2,13,16,17) |
| InChIKey | WJSDMMJMTPTMFM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |