C10H6UV-2 — CID 59779328
1,8-dihydronaphthalene-1,8-diide;uranium;vanadium (PubChem CID 59779328) has the molecular formula C10H6UV-2 and a molecular weight of 415.13 g/mol. Its IUPAC name is 1,8-dihydronaphthalene-1,8-diide;uranium;vanadium.
| Compound Name | 1,8-dihydronaphthalene-1,8-diide;uranium;vanadium |
|---|---|
| PubChem CID | 59779328 |
| Molecular Formula | C10H6UV-2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1,8-dihydronaphthalene-1,8-diide;uranium;vanadium |
| SMILES | [U].[V].[c-]1cccc2ccc[c-]c12 |
| InChI | InChI=1S/C10H6.U.V/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-5,7H;;/q-2;; |
| InChIKey | AJRISFYCKBLGMU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|