About acridine;S-ethyl octanethioate
acridine;S-ethyl octanethioate (PubChem CID 174426267) has the molecular formula C23H29NOS
and a molecular weight of 367.56 g/mol. Its IUPAC name is acridine;S-ethyl octanethioate.
Molecular Properties
| Compound Name | acridine;S-ethyl octanethioate |
| PubChem CID | 174426267 |
| Molecular Formula | C23H29NOS |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | acridine;S-ethyl octanethioate |
| SMILES | CCCCCCCC(=O)SCC.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C10H20OS/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-3-5-6-7-8-9-10(11)12-4-2/h1-9H;3-9H2,1-2H3 |
| InChIKey | FSEFQEIESSGSQN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze acridine;S-ethyl octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;S-ethyl octanethioate?
The IUPAC name of acridine;S-ethyl octanethioate (CID 174426267) is acridine;S-ethyl octanethioate.
What is the SMILES notation for acridine;S-ethyl octanethioate?
The canonical SMILES for acridine;S-ethyl octanethioate is CCCCCCCC(=O)SCC.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;S-ethyl octanethioate?
The InChIKey is FSEFQEIESSGSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C10H20OS/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-3-5-6-7-8-9-10(11)12-4-2/h1-9H;3-9H2,1-2H3.
What are the key properties of acridine;S-ethyl octanethioate?
acridine;S-ethyl octanethioate has a molecular weight of 367.56 g/mol, XLogP of 7.01, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;S-ethyl octanethioate is sourced from PubChem (CID 174426267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).