C19H17BrO — CID 60624731
2-bromo-6-[(3,5-dimethylphenyl)methoxy]naphthalene (PubChem CID 60624731) has the molecular formula C19H17BrO and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-bromo-6-[(3,5-dimethylphenyl)methoxy]naphthalene.
| Compound Name | 2-bromo-6-[(3,5-dimethylphenyl)methoxy]naphthalene |
|---|---|
| PubChem CID | 60624731 |
| Molecular Formula | C19H17BrO |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-bromo-6-[(3,5-dimethylphenyl)methoxy]naphthalene |
| SMILES | Cc1cc(C)cc(COc2ccc3cc(Br)ccc3c2)c1 |
| InChI | InChI=1S/C19H17BrO/c1-13-7-14(2)9-15(8-13)12-21-19-6-4-16-10-18(20)5-3-17(16)11-19/h3-11H,12H2,1-2H3 |
| InChIKey | KIYWMMOPDLZNQC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |