C18H14Cl2O — CID 90146696
2-[(3,4-dichlorophenyl)methoxy]-7-methylnaphthalene (PubChem CID 90146696) has the molecular formula C18H14Cl2O and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methoxy]-7-methylnaphthalene.
| Compound Name | 2-[(3,4-dichlorophenyl)methoxy]-7-methylnaphthalene |
|---|---|
| PubChem CID | 90146696 |
| Molecular Formula | C18H14Cl2O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methoxy]-7-methylnaphthalene |
| SMILES | Cc1ccc2ccc(OCc3ccc(Cl)c(Cl)c3)cc2c1 |
| InChI | InChI=1S/C18H14Cl2O/c1-12-2-4-14-5-6-16(10-15(14)8-12)21-11-13-3-7-17(19)18(20)9-13/h2-10H,11H2,1H3 |
| InChIKey | DMNNTLZCAXMWFW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |