C16H9Cl2NO3 — CID 142747435
pyridin-2-yl 5-(3,4-dichlorophenyl)furan-2-carboxylate (PubChem CID 142747435) has the molecular formula C16H9Cl2NO3 and a molecular weight of 334.16 g/mol. Its IUPAC name is pyridin-2-yl 5-(3,4-dichlorophenyl)furan-2-carboxylate.
| Compound Name | pyridin-2-yl 5-(3,4-dichlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 142747435 |
| Molecular Formula | C16H9Cl2NO3 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | pyridin-2-yl 5-(3,4-dichlorophenyl)furan-2-carboxylate |
| SMILES | O=C(Oc1ccccn1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C16H9Cl2NO3/c17-11-5-4-10(9-12(11)18)13-6-7-14(21-13)16(20)22-15-3-1-2-8-19-15/h1-9H |
| InChIKey | VFRYWLJTLCSYQT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |