C15H16Cl2N2O3S — CID 91688308
3,5-dichloro-4-(cyclohexanecarbonylcarbamothioylamino)benzoic acid (PubChem CID 91688308) has the molecular formula C15H16Cl2N2O3S and a molecular weight of 375.28 g/mol. Its IUPAC name is 3,5-dichloro-4-(cyclohexanecarbonylcarbamothioylamino)benzoic acid.
| Compound Name | 3,5-dichloro-4-(cyclohexanecarbonylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 91688308 |
| Molecular Formula | C15H16Cl2N2O3S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 3,5-dichloro-4-(cyclohexanecarbonylcarbamothioylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(NC(=S)NC(=O)C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2O3S/c16-10-6-9(14(21)22)7-11(17)12(10)18-15(23)19-13(20)8-4-2-1-3-5-8/h6-8H,1-5H2,(H,21,22)(H2,18,19,20,23) |
| InChIKey | ULSRTYKMPSYVFN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|