C12H12Cl2N2O3 — CID 82830786
3,5-dichloro-4-(pyrrolidine-3-carbonylamino)benzoic acid (PubChem CID 82830786) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.14 g/mol. Its IUPAC name is 3,5-dichloro-4-(pyrrolidine-3-carbonylamino)benzoic acid.
| Compound Name | 3,5-dichloro-4-(pyrrolidine-3-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 82830786 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3,5-dichloro-4-(pyrrolidine-3-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(NC(=O)C2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O3/c13-8-3-7(12(18)19)4-9(14)10(8)16-11(17)6-1-2-15-5-6/h3-4,6,15H,1-2,5H2,(H,16,17)(H,18,19) |
| InChIKey | PSVDKQOQOHILIG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |