C21H23Cl2N3O3S2 — CID 4067241
N-[[2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]cyclohexanecarboxamide (PubChem CID 4067241) has the molecular formula C21H23Cl2N3O3S2 and a molecular weight of 500.47 g/mol. Its IUPAC name is N-[[2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]cyclohexanecarboxamide.
| Compound Name | N-[[2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4067241 |
| Molecular Formula | C21H23Cl2N3O3S2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | N-[[2-chloro-5-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]carbamothioyl]cyclohexanecarboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Cl)c(NC(=S)NC(=O)C3CCCCC3)c2)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O3S2/c1-13-7-8-15(11-18(13)23)26-31(28,29)16-9-10-17(22)19(12-16)24-21(30)25-20(27)14-5-3-2-4-6-14/h7-12,14,26H,2-6H2,1H3,(H2,24,25,27,30) |
| InChIKey | HYHJSCQFKPYRIH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|