C21H32ClN3O3S — CID 55482031
N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-3-[cycloheptyl(methyl)amino]propanamide (PubChem CID 55482031) has the molecular formula C21H32ClN3O3S and a molecular weight of 442.03 g/mol. Its IUPAC name is N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-3-[cycloheptyl(methyl)amino]propanamide.
| Compound Name | N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-3-[cycloheptyl(methyl)amino]propanamide |
|---|---|
| PubChem CID | 55482031 |
| Molecular Formula | C21H32ClN3O3S |
| Molecular Weight | 442.03 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-3-[cycloheptyl(methyl)amino]propanamide |
| SMILES | CN(CCC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl)C1CCCCCC1 |
| InChI | InChI=1S/C21H32ClN3O3S/c1-24(17-8-4-2-3-5-9-17)15-12-21(26)23-20-16-18(10-11-19(20)22)29(27,28)25-13-6-7-14-25/h10-11,16-17H,2-9,12-15H2,1H3,(H,23,26) |
| InChIKey | JVKJBVOVBIGTMI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |