C19H30ClN3O5S — CID 43031214
2-[bis(2-methoxyethyl)amino]-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 43031214) has the molecular formula C19H30ClN3O5S and a molecular weight of 447.99 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 43031214 |
| Molecular Formula | C19H30ClN3O5S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | COCCN(CCOC)CC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C19H30ClN3O5S/c1-27-12-10-22(11-13-28-2)15-19(24)21-18-14-16(6-7-17(18)20)29(25,26)23-8-4-3-5-9-23/h6-7,14H,3-5,8-13,15H2,1-2H3,(H,21,24) |
| InChIKey | QFPSRMBQZHRXQU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |