C20H20N4O8S — CID 4968274
2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 4968274) has the molecular formula C20H20N4O8S and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4968274 |
| Molecular Formula | C20H20N4O8S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccco2)C1=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H20N4O8S/c25-17(13-24-19(27)18(26)23(20(24)28)12-15-4-2-8-32-15)21-14-3-1-5-16(11-14)33(29,30)22-6-9-31-10-7-22/h1-5,8,11H,6-7,9-10,12-13H2,(H,21,25) |
| InChIKey | LYNBOHVMVZMAOA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|