C15H18N4O3S — CID 39723892
2-pyrazol-1-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 39723892) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-pyrazol-1-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 39723892 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-pyrazol-1-yl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(Cn1cccn1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H18N4O3S/c20-15(12-18-8-4-7-16-18)17-13-5-3-6-14(11-13)23(21,22)19-9-1-2-10-19/h3-8,11H,1-2,9-10,12H2,(H,17,20) |
| InChIKey | MEACCVLCHTUHGA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |