C19H29N4O3S+ — CID 8717458
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 8717458) has the molecular formula C19H29N4O3S+ and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 8717458 |
| Molecular Formula | C19H29N4O3S+ |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(C[N+]12CCN(CC1)CC2)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H28N4O3S/c24-19(16-23-12-9-21(10-13-23)11-14-23)20-17-5-4-6-18(15-17)27(25,26)22-7-2-1-3-8-22/h4-6,15H,1-3,7-14,16H2/p+1 |
| InChIKey | UNLVZJRUSDJCTF-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|