C21H18ClN5O4 — CID 30833957
7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-6-chloro-4-methylchromen-2-one (PubChem CID 30833957) has the molecular formula C21H18ClN5O4 and a molecular weight of 439.86 g/mol. Its IUPAC name is 7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-6-chloro-4-methylchromen-2-one.
| Compound Name | 7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-6-chloro-4-methylchromen-2-one |
|---|---|
| PubChem CID | 30833957 |
| Molecular Formula | C21H18ClN5O4 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-6-chloro-4-methylchromen-2-one |
| SMILES | COc1ccccc1Nc1nc(N)nc(COc2cc3oc(=O)cc(C)c3cc2Cl)n1 |
| InChI | InChI=1S/C21H18ClN5O4/c1-11-7-19(28)31-16-9-17(13(22)8-12(11)16)30-10-18-25-20(23)27-21(26-18)24-14-5-3-4-6-15(14)29-2/h3-9H,10H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | IDCGFWGIBYQPBH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|