C20H16ClN5O3 — CID 139015091
7-[[4-amino-6-(4-chloro-3-methylanilino)-1,3,5-triazin-2-yl]methoxy]chromen-2-one (PubChem CID 139015091) has the molecular formula C20H16ClN5O3 and a molecular weight of 409.83 g/mol. Its IUPAC name is 7-[[4-amino-6-(4-chloro-3-methylanilino)-1,3,5-triazin-2-yl]methoxy]chromen-2-one.
| Compound Name | 7-[[4-amino-6-(4-chloro-3-methylanilino)-1,3,5-triazin-2-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 139015091 |
| Molecular Formula | C20H16ClN5O3 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 7-[[4-amino-6-(4-chloro-3-methylanilino)-1,3,5-triazin-2-yl]methoxy]chromen-2-one |
| SMILES | Cc1cc(Nc2nc(N)nc(COc3ccc4ccc(=O)oc4c3)n2)ccc1Cl |
| InChI | InChI=1S/C20H16ClN5O3/c1-11-8-13(4-6-15(11)21)23-20-25-17(24-19(22)26-20)10-28-14-5-2-12-3-7-18(27)29-16(12)9-14/h2-9H,10H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | PFKSWLBJLBASQV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|