C18H17ClN2O4S — CID 30766722
N-[4-[(6-chloro-4-methyl-2-oxochromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]-N-ethylacetamide (PubChem CID 30766722) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is N-[4-[(6-chloro-4-methyl-2-oxochromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]-N-ethylacetamide.
| Compound Name | N-[4-[(6-chloro-4-methyl-2-oxochromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 30766722 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[4-[(6-chloro-4-methyl-2-oxochromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)c1nc(COc2cc3oc(=O)cc(C)c3cc2Cl)cs1 |
| InChI | InChI=1S/C18H17ClN2O4S/c1-4-21(11(3)22)18-20-12(9-26-18)8-24-16-7-15-13(6-14(16)19)10(2)5-17(23)25-15/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | MOITZYJKYBRTSY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|