C19H20ClN7O3 — CID 112805991
6-[[(2-chloro-5-nitrophenyl)methyl-methylamino]methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112805991) has the molecular formula C19H20ClN7O3 and a molecular weight of 429.87 g/mol. Its IUPAC name is 6-[[(2-chloro-5-nitrophenyl)methyl-methylamino]methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[(2-chloro-5-nitrophenyl)methyl-methylamino]methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112805991 |
| Molecular Formula | C19H20ClN7O3 |
| Molecular Weight | 429.87 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 6-[[(2-chloro-5-nitrophenyl)methyl-methylamino]methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccccc1Nc1nc(N)nc(CN(C)Cc2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C19H20ClN7O3/c1-26(10-12-9-13(27(28)29)7-8-14(12)20)11-17-23-18(21)25-19(24-17)22-15-5-3-4-6-16(15)30-2/h3-9H,10-11H2,1-2H3,(H3,21,22,23,24,25) |
| InChIKey | WKPJQMLJJSYQBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|