C18H16FN5O2 — CID 2523878
[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 3-fluorobenzoate (PubChem CID 2523878) has the molecular formula C18H16FN5O2 and a molecular weight of 353.36 g/mol. Its IUPAC name is [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 3-fluorobenzoate.
| Compound Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 3-fluorobenzoate |
|---|---|
| PubChem CID | 2523878 |
| Molecular Formula | C18H16FN5O2 |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 3-fluorobenzoate |
| SMILES | Cc1ccccc1Nc1nc(N)nc(COC(=O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H16FN5O2/c1-11-5-2-3-8-14(11)21-18-23-15(22-17(20)24-18)10-26-16(25)12-6-4-7-13(19)9-12/h2-9H,10H2,1H3,(H3,20,21,22,23,24) |
| InChIKey | POBLVADOKDZENC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |