C20H18FN5O2 — CID 7669879
[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 7669879) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7669879 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccccc1Nc1nc(N)nc(COC(=O)/C=C/c2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H18FN5O2/c1-13-5-2-3-8-16(13)23-20-25-17(24-19(22)26-20)12-28-18(27)10-9-14-6-4-7-15(21)11-14/h2-11H,12H2,1H3,(H3,22,23,24,25,26)/b10-9+ |
| InChIKey | INJXZSOCZUFCEM-MDZDMXLPSA-N |
| XLogP | 3.40 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|