C22H22FN5O5 — CID 27213748
[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 27213748) has the molecular formula C22H22FN5O5 and a molecular weight of 455.45 g/mol. Its IUPAC name is [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 27213748 |
| Molecular Formula | C22H22FN5O5 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2nc(N)nc(Nc3ccc(F)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22FN5O5/c1-30-16-10-13(11-17(31-2)20(16)32-3)4-9-19(29)33-12-18-26-21(24)28-22(27-18)25-15-7-5-14(23)6-8-15/h4-11H,12H2,1-3H3,(H3,24,25,26,27,28)/b9-4+ |
| InChIKey | QBBNUUWNSYGOPP-RUDMXATFSA-N |
| XLogP | 3.12 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|