C15H17N5O2 — CID 7663688
[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-but-2-enoate (PubChem CID 7663688) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-but-2-enoate.
| Compound Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 7663688 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCc1nc(N)nc(Nc2ccccc2C)n1 |
| InChI | InChI=1S/C15H17N5O2/c1-3-6-13(21)22-9-12-18-14(16)20-15(19-12)17-11-8-5-4-7-10(11)2/h3-8H,9H2,1-2H3,(H3,16,17,18,19,20)/b6-3+ |
| InChIKey | UDASBBXGMHTNKS-ZZXKWVIFSA-N |
| XLogP | 2.13 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|