C18H16Cl2N6O2 — CID 18226008
[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 2-amino-3,5-dichlorobenzoate (PubChem CID 18226008) has the molecular formula C18H16Cl2N6O2 and a molecular weight of 419.27 g/mol. Its IUPAC name is [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 2-amino-3,5-dichlorobenzoate.
| Compound Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 18226008 |
| Molecular Formula | C18H16Cl2N6O2 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl 2-amino-3,5-dichlorobenzoate |
| SMILES | Cc1ccccc1Nc1nc(N)nc(COC(=O)c2cc(Cl)cc(Cl)c2N)n1 |
| InChI | InChI=1S/C18H16Cl2N6O2/c1-9-4-2-3-5-13(9)23-18-25-14(24-17(22)26-18)8-28-16(27)11-6-10(19)7-12(20)15(11)21/h2-7H,8,21H2,1H3,(H3,22,23,24,25,26) |
| InChIKey | NDVDLJNMADVAIT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|