C22H24F2N2O6S — CID 30656702
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 30656702) has the molecular formula C22H24F2N2O6S and a molecular weight of 482.51 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 30656702 |
| Molecular Formula | C22H24F2N2O6S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)OCC(=O)Nc3ccc(OC(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H24F2N2O6S/c1-15-10-12-26(13-11-15)33(29,30)19-8-2-16(3-9-19)21(28)31-14-20(27)25-17-4-6-18(7-5-17)32-22(23)24/h2-9,15,22H,10-14H2,1H3,(H,25,27) |
| InChIKey | WUFGJCOYOBSQBK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |