C21H24N2O5S — CID 8915508
(4-acetamidophenyl) 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 8915508) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is (4-acetamidophenyl) 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (4-acetamidophenyl) 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 8915508 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (4-acetamidophenyl) 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15-11-13-23(14-12-15)29(26,27)20-9-3-17(4-10-20)21(25)28-19-7-5-18(6-8-19)22-16(2)24/h3-10,15H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | QQLVRGCSWFSXAO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|