C24H20N2O4 — CID 2383248
[2-oxo-2-(4-phenoxyanilino)ethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 2383248) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 2383248 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1c[nH]c2ccccc12)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O4/c27-23(16-29-24(28)14-17-15-25-22-9-5-4-8-21(17)22)26-18-10-12-20(13-11-18)30-19-6-2-1-3-7-19/h1-13,15,25H,14,16H2,(H,26,27) |
| InChIKey | GWPRJPCSBNLLOQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |