C17H22N4O2 — CID 134107242
[(Z)-[1-amino-2-(1H-indol-3-yl)ethylidene]amino] N-cyclohexylcarbamate (PubChem CID 134107242) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is [(Z)-[1-amino-2-(1H-indol-3-yl)ethylidene]amino] N-cyclohexylcarbamate.
| Compound Name | [(Z)-[1-amino-2-(1H-indol-3-yl)ethylidene]amino] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 134107242 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [(Z)-[1-amino-2-(1H-indol-3-yl)ethylidene]amino] N-cyclohexylcarbamate |
| SMILES | N/C(Cc1c[nH]c2ccccc12)=N\OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H22N4O2/c18-16(10-12-11-19-15-9-5-4-8-14(12)15)21-23-17(22)20-13-6-2-1-3-7-13/h4-5,8-9,11,13,19H,1-3,6-7,10H2,(H2,18,21)(H,20,22) |
| InChIKey | VNUBVQNYJNFYHY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|