C22H25FN2O4 — CID 8662703
[(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 8662703) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is [(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8662703 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)OC(=O)CNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H25FN2O4/c1-4-14(2)18-10-5-6-11-19(18)25-21(27)15(3)29-20(26)13-24-22(28)16-8-7-9-17(23)12-16/h5-12,14-15H,4,13H2,1-3H3,(H,24,28)(H,25,27)/t14-,15-/m1/s1 |
| InChIKey | WKXKYPZKZPKOTA-HUUCEWRRSA-N |
| XLogP | 3.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |