C23H29FN2O4 — CID 42900435
[1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(1-adamantylcarbamoylamino)propanoate (PubChem CID 42900435) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(1-adamantylcarbamoylamino)propanoate.
| Compound Name | [1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(1-adamantylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 42900435 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [1-(4-fluorophenyl)-1-oxopropan-2-yl] 3-(1-adamantylcarbamoylamino)propanoate |
| SMILES | CC(OC(=O)CCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN2O4/c1-14(21(28)18-2-4-19(24)5-3-18)30-20(27)6-7-25-22(29)26-23-11-15-8-16(12-23)10-17(9-15)13-23/h2-5,14-17H,6-13H2,1H3,(H2,25,26,29) |
| InChIKey | VHCRVZWTHRCXNX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |