C20H23NO4 — CID 102487068
N-benzyl-N-[1-(3,4,5-trimethoxyphenyl)ethenyl]acetamide (PubChem CID 102487068) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-benzyl-N-[1-(3,4,5-trimethoxyphenyl)ethenyl]acetamide.
| Compound Name | N-benzyl-N-[1-(3,4,5-trimethoxyphenyl)ethenyl]acetamide |
|---|---|
| PubChem CID | 102487068 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-benzyl-N-[1-(3,4,5-trimethoxyphenyl)ethenyl]acetamide |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)N(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C20H23NO4/c1-14(21(15(2)22)13-16-9-7-6-8-10-16)17-11-18(23-3)20(25-5)19(12-17)24-4/h6-12H,1,13H2,2-5H3 |
| InChIKey | LDQAAGJKXUKWPC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |