C30H33NO5 — CID 11134690
N-benzyl-N-[(1Z)-1,2-bis(3,4-dimethoxyphenyl)penta-1,4-dienyl]acetamide (PubChem CID 11134690) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-benzyl-N-[(1Z)-1,2-bis(3,4-dimethoxyphenyl)penta-1,4-dienyl]acetamide.
| Compound Name | N-benzyl-N-[(1Z)-1,2-bis(3,4-dimethoxyphenyl)penta-1,4-dienyl]acetamide |
|---|---|
| PubChem CID | 11134690 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-benzyl-N-[(1Z)-1,2-bis(3,4-dimethoxyphenyl)penta-1,4-dienyl]acetamide |
| SMILES | C=CC/C(=C(\c1ccc(OC)c(OC)c1)N(Cc1ccccc1)C(C)=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C30H33NO5/c1-7-11-25(23-14-16-26(33-3)28(18-23)35-5)30(24-15-17-27(34-4)29(19-24)36-6)31(21(2)32)20-22-12-9-8-10-13-22/h7-10,12-19H,1,11,20H2,2-6H3/b30-25- |
| InChIKey | VSFQQBKTHGIEMB-JVCXMKTPSA-N |
| XLogP | 6.21 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|