C23H21NO3 — CID 54368965
3-(3,4-dimethoxyphenyl)-2-(4-ethenylbenzoyl)hexa-2,5-dienenitrile (PubChem CID 54368965) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(4-ethenylbenzoyl)hexa-2,5-dienenitrile.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(4-ethenylbenzoyl)hexa-2,5-dienenitrile |
|---|---|
| PubChem CID | 54368965 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(4-ethenylbenzoyl)hexa-2,5-dienenitrile |
| SMILES | C=CCC(=C(C#N)C(=O)c1ccc(C=C)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H21NO3/c1-5-7-19(18-12-13-21(26-3)22(14-18)27-4)20(15-24)23(25)17-10-8-16(6-2)9-11-17/h5-6,8-14H,1-2,7H2,3-4H3 |
| InChIKey | URTYQQRRMYHRFA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|