C15H17ClO4 — CID 53467485
[(1Z)-2-chloro-1-(3,4-dimethoxyphenyl)penta-1,4-dienyl] acetate (PubChem CID 53467485) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is [(1Z)-2-chloro-1-(3,4-dimethoxyphenyl)penta-1,4-dienyl] acetate.
| Compound Name | [(1Z)-2-chloro-1-(3,4-dimethoxyphenyl)penta-1,4-dienyl] acetate |
|---|---|
| PubChem CID | 53467485 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [(1Z)-2-chloro-1-(3,4-dimethoxyphenyl)penta-1,4-dienyl] acetate |
| SMILES | C=CC/C(Cl)=C(/OC(C)=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H17ClO4/c1-5-6-12(16)15(20-10(2)17)11-7-8-13(18-3)14(9-11)19-4/h5,7-9H,1,6H2,2-4H3/b15-12- |
| InChIKey | KPHZLULIONNWQA-QINSGFPZSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|