C19H17F4NO2 — CID 174876495
N-[(2S)-2-(4-fluorophenyl)-4-oxobutyl]-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 174876495) has the molecular formula C19H17F4NO2 and a molecular weight of 367.34 g/mol. Its IUPAC name is N-[(2S)-2-(4-fluorophenyl)-4-oxobutyl]-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-2-(4-fluorophenyl)-4-oxobutyl]-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174876495 |
| Molecular Formula | C19H17F4NO2 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[(2S)-2-(4-fluorophenyl)-4-oxobutyl]-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | CN(C[C@@H](CC=O)c1ccc(F)cc1)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F4NO2/c1-24(12-15(9-10-25)13-5-7-17(20)8-6-13)18(26)14-3-2-4-16(11-14)19(21,22)23/h2-8,10-11,15H,9,12H2,1H3/t15-/m1/s1 |
| InChIKey | UPQAMXZTZUSRPD-OAHLLOKOSA-N |
| XLogP | 4.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|