C19H17BrF4INO — CID 143430793
3-bromo-N-[2-(4-fluorophenyl)-4-iodobutyl]-N-methyl-5-(trifluoromethyl)benzamide (PubChem CID 143430793) has the molecular formula C19H17BrF4INO and a molecular weight of 558.15 g/mol. Its IUPAC name is 3-bromo-N-[2-(4-fluorophenyl)-4-iodobutyl]-N-methyl-5-(trifluoromethyl)benzamide.
| Compound Name | 3-bromo-N-[2-(4-fluorophenyl)-4-iodobutyl]-N-methyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143430793 |
| Molecular Formula | C19H17BrF4INO |
| Molecular Weight | 558.15 g/mol |
| Exact Mass | 556.95 |
| IUPAC Name | 3-bromo-N-[2-(4-fluorophenyl)-4-iodobutyl]-N-methyl-5-(trifluoromethyl)benzamide |
| SMILES | CN(CC(CCI)c1ccc(F)cc1)C(=O)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17BrF4INO/c1-26(11-13(6-7-25)12-2-4-17(21)5-3-12)18(27)14-8-15(19(22,23)24)10-16(20)9-14/h2-5,8-10,13H,6-7,11H2,1H3 |
| InChIKey | CFIUJVMYMFTKRB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.15 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|