C20H16F7NO2 — CID 139705820
N-[(4-fluorophenyl)methyl]-N-[(2S)-4-oxobutan-2-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 139705820) has the molecular formula C20H16F7NO2 and a molecular weight of 435.34 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[(2S)-4-oxobutan-2-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[(2S)-4-oxobutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139705820 |
| Molecular Formula | C20H16F7NO2 |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[(2S)-4-oxobutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C[C@@H](CC=O)N(Cc1ccc(F)cc1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F7NO2/c1-12(6-7-29)28(11-13-2-4-17(21)5-3-13)18(30)14-8-15(19(22,23)24)10-16(9-14)20(25,26)27/h2-5,7-10,12H,6,11H2,1H3/t12-/m0/s1 |
| InChIKey | JCJBZIJTQQHDDS-LBPRGKRZSA-N |
| XLogP | 5.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|